14857-34-2 Dimethylethoxysilane
| Ονομασ?α του προ??ντο? |
Dimethylethoxysilane |
| Αγγλικ? ?νομα |
Dimethylethoxysilane; Ethoxydimethylsilane; Ethoxydimethylvinylsilane; Vinyldimethylethoxysilane; ethoxy(dimethyl)silyl |
| MF |
C4H11OSi |
| Μοριακ? β?ρο? |
103.215 |
| InChI |
InChI=1/C4H11OSi/c1-4-5-6(2)3/h4H2,1-3H3 |
| CAS ΟΧΙ |
14857-34-2 |
| EINECS |
238-921-7 |
| Μοριακ? δομ? |
|
| Κινδ?νου Κ?δικε? |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|