1210-33-9 5-Chlorodibenzosuberane
| Ονομασ?α του προ??ντο? |
5-Chlorodibenzosuberane |
| Αγγλικ? ?νομα |
5-Chlorodibenzosuberane; 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene; 5-Chlorobenzosuberane; 5H-Dibenzo[a,d]cycloheptene, 5-chloro-10,11-dihydro-; 5-chloro-10,11-dihydro-5H-dibenzo[a,d][7]annulene; 5-Chloro dibenzosuberane; Dibenzosuberyl chloride; 5-Chloro dibenzosuberane; 5-Chloro-10,11-dihydro-5H-dibenzo[a,d]cycloheptene |
| MF |
C15H13Cl |
| Μοριακ? β?ρο? |
228.7167 |
| InChI |
InChI=1/C15H13Cl/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15H,9-10H2 |
| CAS ΟΧΙ |
1210-33-9 |
| EINECS |
214-910-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.19g/cm3 |
| Σημε?ο βρασμο? |
321.738°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.627 |
| Σημε?ο αν?φλεξη? |
136.593°C |
| Π?εση ατμ?ν |
0.001mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
34:;
|
| Κινδ?νου Κ?δικε? |
R34:Causes burns.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|