5408-52-6 L-Lysine L-glutamate
| Nom |
L-Lysine L-glutamate |
| Nom anglais |
L-Lysine L-glutamate; Lysine glutamate; NSC 10855; Glutamic acid, L-, compd. with L-lysine (1:1); L-Glutamic acid, compd. with L-lysine (1:1); L-glutamic acid-L-lysine (1:1); glutamic acid-lysine (1:1); L-Lysine-L-Glutamate; L-Lys L-Glu; L-Lysine L-Glutamate |
| Formule moléculaire |
C11H23N3O6 |
| Poids Moléculaire |
293.3168 |
| InChI |
InChI=1/C6H14N2O2.C5H9NO4/c7-4-2-1-3-5(8)6(9)10;6-3(5(9)10)1-2-4(7)8/h5H,1-4,7-8H2,(H,9,10);3H,1-2,6H2,(H,7,8)(H,9,10) |
| Numéro de registre CAS |
5408-52-6 |
| EINECS |
226-474-0 |
| Structure moléculaire |
|
| Point d'ébullition |
311.5°C at 760 mmHg |
| Point d'éclair |
142.2°C |
| Pression de vapeur |
0.000123mmHg at 25°C |
|