526-31-8 N-Methyl-L-tryptophan
| Nom |
N-Methyl-L-tryptophan |
| Nom anglais |
N-Methyl-L-tryptophan; H-N-Me-Trp-OH; L-ABRINE; L-(+)-Abrine; (2S)-3-(1H-Indol-3-yl)-2-(methylammonio)propanoate |
| Formule moléculaire |
C12H14N2O2 |
| Poids Moléculaire |
218.2518 |
| InChI |
InChI=1/C12H14N2O2/c1-13-11(12(15)16)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,13-14H,6H2,1H3,(H,15,16)/t11-/m0/s1 |
| Numéro de registre CAS |
526-31-8 |
| EINECS |
208-388-5 |
| Structure moléculaire |
|
| Densité |
1.272g/cm3 |
| Point de fusion |
295℃ |
| Point d'ébullition |
439.1°C at 760 mmHg |
| Indice de réfraction |
1.648 |
| Point d'éclair |
219.4°C |
| Pression de vapeur |
1.74E-08mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|