488-81-3 Adonitol
| Nom |
Adonitol |
| Nom anglais |
Adonitol; Ribitol; Ribit = Ribitol = Adonitol; pentitol; D-ribitol; (2S,4R)-pentane-1,2,3,4,5-pentol |
| Formule moléculaire |
C5H12O5 |
| Poids Moléculaire |
152.1458 |
| InChI |
InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5? |
| Numéro de registre CAS |
488-81-3 |
| EINECS |
207-685-7 |
| Structure moléculaire |
|
| Densité |
1.525g/cm3 |
| Point de fusion |
101-104℃ |
| Point d'ébullition |
494.5°C at 760 mmHg |
| Indice de réfraction |
1.57 |
| Point d'éclair |
261.9°C |
| Pression de vapeur |
7.47E-12mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|