645-49-8 cis-Stilbene
| Nombre del producto |
cis-Stilbene |
| Nombre en inglés |
cis-Stilbene; cis-1,1-(1,2-Ethenediyl)bis(benzene); cis-Stilbene, (cis-1,2-Diphenylethylene); ((E)-2-phenylethenyl)benzene; Stilbebe; cis-1,2-Diphenylethylene; cis-Stilbebe |
| Fórmula molecular |
C14H12 |
| Peso Molecular |
180.24
|
| InChI |
InChI=1/C14H12/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14/h1-12H/b12-11- |
| Número de registro CAS |
645-49-8 |
| EINECS |
211-445-7 |
| Estructura Molecular |
|
| Densidad |
1.01 |
| Punto de fusión |
-5℃ |
| Punto de ebullición |
82-84℃ (0.4 torr) |
| índice de refracción |
1.621-1.623 |
| Descripción de Seguridad |
S24/25:Avoid contact with skin and eyes.;
|
|