608-05-9 5-methylisatin
| Nombre del producto |
5-methylisatin |
| Nombre en inglés |
5-methylisatin; 5-methylindole-2,3(1H)-dione; 5-methyl-1H-indole-2,3-dione |
| Fórmula molecular |
C9H7NO2 |
| Peso Molecular |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
| Número de registro CAS |
608-05-9 |
| EINECS |
210-152-1 |
| Estructura Molecular |
|
| Densidad |
1.301g/cm3 |
| Punto de fusión |
180℃ (dec.) |
| índice de refracción |
1.598 |
| Descripción de Seguridad |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|