536-89-0 m-Tolylhydrazine
| Nombre del producto |
m-Tolylhydrazine |
| Nombre en inglés |
m-Tolylhydrazine; (3-methyl-phenyl)-hydrazine |
| Fórmula molecular |
C7H10N2 |
| Peso Molecular |
122.16 |
| InChI |
InChI=1/C7H10N2/c1-6-3-2-4-7(5-6)9-8/h2-5,9H,8H2,1H3 |
| Número de registro CAS |
536-89-0 |
| EINECS |
208-650-9 |
| Estructura Molecular |
|
| Densidad |
1.057 |
| Códigos de Riesgos |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descripción de Seguridad |
S36/37:Wear suitable protective clothing and gloves.;
|
|