320-65-0 2-fluorobenzal chloride
| Nombre del producto |
2-fluorobenzal chloride |
| Nombre en inglés |
2-fluorobenzal chloride; alpha,alpha-Dichloro-2-fluorotoluene |
| Fórmula molecular |
C7H5Cl2F |
| Peso Molecular |
179.02
|
| InChI |
InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
| Número de registro CAS |
320-65-0 |
| EINECS |
206-279-7 |
| Estructura Molecular |
|
| Densidad |
1.3 |
| Punto de ebullición |
224℃ |
| Códigos de Riesgos |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Descripción de Seguridad |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|