97-30-3 Alpha-D-Methylglucoside
| product Name |
Alpha-D-Methylglucoside |
| CAS No |
97-30-3;25360-06-9 |
| Synonyms |
Methyl alpha-D-glucopyranoside; methyl alpha-D-glucopyranoside; Methyl-alpha-D-glucopyranoside; Methyl-α-D-glucopyranoside; Methyl alpha-D-glucopyranose; Alfa methyl glucoside |
| Molecular Formula |
C7H13O6 |
| Molecular Weight |
193.1751 |
| InChI |
InChI=1/C7H13O6/c1-12-6-5(10)4(9)3(2-8)13-7(6)11/h3-10H,2H2,1H3/q-1/t3-,4-,5+,6-,7+/m1/s1 |
| EINECS |
202-571-3 |
| Molecular Structure |
|
| Density |
1.47g/cm3 |
| Melting point |
169-171℃ |
| Boiling point |
389.1°C at 760 mmHg |
| Refractive index |
1.548 |
| Flash point |
189.1°C |
| Water solubility |
108 g/100 mL (20℃) |
| Vapour Pressur |
1.15E-07mmHg at 25°C |
| Safety Description |
S24/25:;
|
|
Featured China Suppliers
| Description |
Name alpha-D-Methylglucoside Synonyms Methyl-alpha-D-glucopyranoside Molecular Structure CAS # 97-30-3, alpha-D-Methylglucoside, Methyl-alpha-D-glucopyranoside Molecular Formula C7H14O6 Molecular Weight 194.18 CAS Number 97-30-3 Usage Voglibose Package According to the requirements |
| Contact |
Mr Yu |
| Telephone |
021-51303635 |
| Email |
sale@daishangchem.com |
| Address |
Rm.1805-1813,Silver Bridge Tower,No.58,Jinxin Road,Pudong District, Shanghai 201206,China. |
| Contact |
sir |
| Telephone |
430313683083 |
| Email |
enquiries@carbopharm.com |
| Address |
Industriestrasse 10 A-8502 Lannach AUSTRIA |