959-33-1 4-Methoxychalcone
| product Name |
4-Methoxychalcone |
| CAS No |
959-33-1 |
| Synonyms |
(4-Methoxybenzylidene)acetophenone; 3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one; (2E)-1-(2-hydroxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one; 1-Phenyl-3-(4-methoxyphenyl)-2-propenone |
| Molecular Formula |
C16H14O2 |
| Molecular Weight |
238.28 |
| InChI |
InChI=1S/C16H14O2/c1-18-15-10-7-13(8-11-15)9-12-16(17)14-5-3-2-4-6-14/h2-12H,1H3/b12-9+ |
| EINECS |
213-499-7 |
| Molecular Structure |
|
| Density |
1.197g/cm3 |
| Melting point |
75-76℃ |
| Boiling point |
444.8°C at 760 mmHg |
| Refractive index |
1.631 |
| Flash point |
167.3°C |
| Vapour Pressur |
1.59E-08mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R38:Irritating to skin.;
|
| Safety Description |
S37:Wear suitable gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
41764749051 |
| Email |
sales@edasascientific.com |
| Address |
Leninskie Gory 1/3, Chemistry Department of Moscow State University 119192 Moscow RUSSIAN FEDERATION |