ChemNet > CAS > 942-26-7 Chlorotryptamine hydrochloride
942-26-7 Chlorotryptamine hydrochloride
| product Name |
Chlorotryptamine hydrochloride |
| CAS No |
942-26-7 |
| Synonyms |
5-Chlorotryptamine hydrochloride; 2-(5-chloro-1H-indol-3-yl)ethanaminium; 2-(5-Chloro-1H-indol-3-yl)ethanamine hydrochloride; 5-chloro tryptamine hydrochloride |
| Molecular Formula |
C10H12ClN2 |
| Molecular Weight |
195.6681 |
| InChI |
InChI=1/C10H11ClN2/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10/h1-2,5-6,13H,3-4,12H2/p+1 |
| EINECS |
213-387-8 |
| Molecular Structure |
|
| Boiling point |
375.7°C at 760 mmHg |
| Flash point |
181°C |
| Vapour Pressur |
7.61E-06mmHg at 25°C |
| Risk Codes |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
Featured China Suppliers
| Contact |
Mr.Wu |
| Telephone |
86-571-88938521 |
| Email |
sales@fstchem.com |
| Address |
17F,building 7,XichengBosi,158 Zixuan Road,Sandun Town,HangZhou??China |
| Telephone |
+86-571-88823979 88195031 |
| Email |
jzchem4s@gmail.com |
| Address |
No. 1265, Moganshan Road, Hangzhou, 310011, China, |