ChemNet > CAS > 94-32-6 ethyl 4-(butylamino)benzoate
94-32-6 ethyl 4-(butylamino)benzoate
| product Name |
ethyl 4-(butylamino)benzoate |
| CAS No |
94-32-6 |
| Synonyms |
Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
| Molecular Formula |
C13H19NO2 |
| Molecular Weight |
221.2955 |
| InChI |
InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
| EINECS |
202-322-9 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Melting point |
68-70℃ |
| Boiling point |
338.4°C at 760 mmHg |
| Refractive index |
1.534 |
| Flash point |
158.4°C |
| Vapour Pressur |
9.87E-05mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Telephone |
0086-519-83138042;83137042;83137041;0086-519-83139028(english);83131668(english) |
| Email |
info@sunlightchem.com |
| Address |
JiuliStreet, Benniu Town Changzhou, Jiangsu Province, China. |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Contact |
Shelley Qian |
| Telephone |
021-57857285 |
| Email |
sales02@reliabpharma.com |
| Address |
Lane 1500, No.68, Xinfei Road, Songjiang District, Shanghai, China. |