925-78-0 3-Nonanone
| product Name |
3-Nonanone |
| CAS No |
925-78-0 |
| Synonyms |
Ethyl n-hexyl ketone; nonan-3-one |
| Molecular Formula |
C9H18O |
| Molecular Weight |
142.2386 |
| InChI |
InChI=1/C9H18O/c1-3-5-6-7-8-9(10)4-2/h3-8H2,1-2H3 |
| EINECS |
213-125-2 |
| Molecular Structure |
|
| Density |
0.816g/cm3 |
| Melting point |
-8℃ |
| Boiling point |
190.1°C at 760 mmHg |
| Refractive index |
1.416 |
| Flash point |
67.8°C |
| Vapour Pressur |
0.551mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|