89-59-8 neoagarohexaitol
| product Name |
neoagarohexaitol |
| CAS No |
89-59-8 |
| Synonyms |
Benzene, 4-chloro-1-methyl-2-nitro-; 2-Nitro-4-chlorotoluene; 4-Chloro-2-nitrotoluene; AI3-00494; CCRIS 3116; NSC 5386; p-Chloro-o-nitrotoluene; Benzene, 4-chloro-1-methyl-3-nitro-; Toluene, 4-chloro-2-nitro-; 4-chloro-1-methyl-2-nitrobenzene; 4-Chloro-2-nitro toluene |
| Molecular Formula |
C7H6ClNO2 |
| Molecular Weight |
171.581 |
| InChI |
InChI=1/C7H6ClNO2/c1-5-2-3-6(8)4-7(5)9(10)11/h2-4H,1H3 |
| EINECS |
201-921-2 |
| Molecular Structure |
|
| Density |
1.324g/cm3 |
| Melting point |
35-37℃ |
| Boiling point |
238.5°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
98.1°C |
| Water solubility |
109 mg/L (20℃) |
| Vapour Pressur |
0.0651mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:;
R36/37/38:;
|
| Safety Description |
S26:;
S36/37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Chen Leilei;Lu Fei |
| Telephone |
+86-517-80899848;80898688;80899879 |
| Email |
sales@yongchuangchem.com |
| Address |
No.102 Mid Jiangdong Rd, Nanjing, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Contact |
Ida Zhang |
| Telephone |
+86-571-28935877 |
| Email |
zhangjunling0916@126.com MSN: zhangjunling0916@msn.com |
| Address |
ZMC Building,101-2N,Zhongshan Road,Hangzhou,China |
| Specifications |
99% min |
| Packing |
25kg 50kg drum or bag |
| Description |
What is the chemical of 4-Chloro-2-Nitrotoluene? Appearance: White or colorless to yellow powder?? Assay:99%min by HPLC?? IR Identity: conform to standard?? HNMR?? conform to standard?? carbon spectrum: conform to standard?? Water by K. F.:0.5% max or as per the customer??s request?? Loss on drying:0.5% max. or as per the customer??s request?? ========================================================================= Uses: 4-Chloro-2-nitrotoluene is primarily an important organic synthesis intermediate, with specific applications including: In the dye industry, it is a key raw material for synthesizing ice dye red base KB and naphthol AS-KB; It can be used to prepare various ani-ine derivatives through reaction pathways such as reduction, oxidation, and borylation; Its downstream products include 2,6-dichlorotoluene, 2-methoxy-5-methyl anil-ine, and ethyl 6-chloroindole-2-carboxylate, etc. ============================================================================== Synthesis Route... |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |