823-22-3 delta-Hexanolactone
| product Name |
delta-Hexanolactone |
| CAS No |
823-22-3 |
| Synonyms |
delta-Hexalactone; 5-Hydroxyhexanoic acid lactone; 6-methyltetrahydro-2H-pyran-2-one; (6S)-6-methyltetrahydro-2H-pyran-2-one |
| Molecular Formula |
C6H10O2 |
| Molecular Weight |
114.1424 |
| InChI |
InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
| EINECS |
212-511-8 |
| Molecular Structure |
|
| Density |
1.001g/cm3 |
| Boiling point |
215.7°C at 760 mmHg |
| Refractive index |
1.43 |
| Flash point |
79.8°C |
| Vapour Pressur |
0.145mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr.Sunny Su |
| Telephone |
0086-573-82850871 |
| Email |
su@promocreat.com |
| Address |
604, Building 2, Hualong Plaza, Jiaxing, Zhejiang, China |
| Contact |
Michael Gan(garoms) |
| Telephone |
+86-573-82262042 |
| Email |
garoms@163.com |
| Address |
No.225, Dongqing Road |