8002-89-9 Theophyllol
| product Name |
Theophyllol |
| CAS No |
8002-89-9 |
| Synonyms |
Theophylline sodium acetate; Acet-theocin sodium; Acetic acid, sodium salt, mixt. with 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione sodium salt; Theacitin; Theocin soluble; Theophylline, compd. with sodium acetate (1:1); Theophylline, sodium acetate; Theophyllinum natrium aceticum; Theophyllinum natrium aceticum [German]; UNII-88AO1K4HJ3; Acetic acid, sodium salt, compd. with theophylline (1:1) |
| Molecular Formula |
C9H10N4Na2O4 |
| Molecular Weight |
284.1796 |
| InChI |
InChI=1/C7H8N4O2.C2H4O2.2Na/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;1-2(3)4;;/h3H,1-2H3,(H,8,9,12);1H3,(H,3,4);;/q;;2*+1/p-2 |
| Molecular Structure |
|
|