79-14-1 Glycolic acid
| product Name |
Glycolic acid |
| CAS No |
79-14-1 |
| Synonyms |
Hydroxyacetic acid; glycollic acid; Hydroxyethanoic acid; 2-hydroxyacetate; Total acid; AHA-glycolic acid |
| Molecular Formula |
C2H4O3 |
| Molecular Weight |
76.0506 |
| InChI |
InChI=1/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1 |
| EINECS |
201-180-5 |
| Molecular Structure |
|
| Melting point |
10℃ |
| Boiling point |
265.571°C at 760 mmHg |
| Flash point |
128.665°C |
| Water solubility |
SOLUBLE |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R22:;
R34:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Specifications |
99% |
| Packing |
25kg Fiber Can |
| Description |
Usage: 1. Medicine: Sutures, Glycolic Acid crystal(99%) can be used in the synthesis of medicine 2. Industrial: Glycolic acid 70% solution mainly used as cleaning agent. Mixture of 2% glycolic acid and 1% formic acid effective and cleaning agent used in cleaning of air conditioner, boiler, electric plant pipe, Oil pipeline, etc. 3. Cosmetics and personal care applications: Glycolic acid effective medicine to get rid of fine hair, dead skin and wrinkle. It can prevent aging of skin and widely used in skin care area 4. Household and institutional cleaning: Used in synthesis of cosmetic, petrol emulsion breaker, solder, etc. Can also improve quality of nickel plating. |
| Contact |
Mr. Wu |
| Telephone |
+86-523-87676091 |
| Email |
info@water-chemical.com |
| Address |
No.16,Binjiang Road, Economic Development Zone, Taixing, Jiangsu Province, China |
| Contact |
Lu Jianping |
| Telephone |
+86-512-512-52559191;52513636;52559090 |
| Email |
wang@jchg.com |
| Address |
ZhitangIndustrial Park, Changshu,P. R. China |
| Telephone |
+86-21-33926680 |
| Email |
sales@consonchem.com |
| Address |
Room 805,Information Tower No.1403 Minsheng Road,Pudong New Area, Shanghai 200135, P. R. China |
| Telephone |
+86-311-87503088 87503066 |
| Email |
taida@hi2000.com |
| Address |
No.6, Nanhua Road,South Street, Xinji City Road,Hebei Province,China |
| Contact |
Jiang Biao |
| Telephone |
+86-25-83479682 |
| Email |
paul@3cchem.com |
| Address |
Room 2107, Li??ao Building, No.323, Zhongyang Road,Nanjing City, Jiangsu Province, China. |