784-04-3 9-Acetylanthracene
| product Name |
9-Acetylanthracene |
| CAS No |
784-04-3 |
| Synonyms |
9-Anthryl methyl ketone; 1-(anthracen-9-yl)ethanone |
| Molecular Formula |
C16H12O |
| Molecular Weight |
220.2659 |
| InChI |
InChI=1/C16H12O/c1-11(17)16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-10H,1H3 |
| EINECS |
212-315-2 |
| Molecular Structure |
|
| Density |
1.164g/cm3 |
| Melting point |
72-76℃ |
| Boiling point |
405.9°C at 760 mmHg |
| Refractive index |
1.685 |
| Flash point |
180.7°C |
| Vapour Pressur |
8.47E-07mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|