770-71-8 1-Adamantanemethanol
| product Name |
1-Adamantanemethanol |
| CAS No |
770-71-8 |
| Synonyms |
tricyclo(3.3.1.13,7)dec-1-ylmethanol; 1-(Hydroxymethyl)adamantane; 1-Tricyclo[3.3.1.1(3,7)]decanemethanol; 1-Adamantane Methanol; tricyclo[3.3.1.1~3,7~]dec-1-ylmethanol |
| Molecular Formula |
C11H18O |
| Molecular Weight |
166.26 |
| InChI |
InChI=1/C11H18O/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,12H,1-7H2 |
| EINECS |
212-225-3 |
| Molecular Structure |
|
| Density |
1.088g/cm3 |
| Melting point |
115-118℃ |
| Boiling point |
263.1°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
123.4°C |
| Water solubility |
Soluble in organic solvents,insoluble in water |
| Vapour Pressur |
0.00148mmHg at 25°C |
| Safety Description |
S22:;
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Specifications |
98.5% |
| Description |
1-Adamantane Methanol ??Chemical Name??1-Adamantane Methanol ??Synonym??1-Adamantylcarbinol; 1-Adamantylmethanol; 1-(Hydroxymethyl)-adamantane ??CAS No??770-71-8 ??Molecular Formula??C11H18O ??Molecular Weight??166.26 ??Structural Formula?? ??Properties??White crystalline powder; Melting Point: 116.0-119.0 deg C; Soluble in organic solvents,insoluble in water. ??Specification????98.5% (GC) ??Packing??25kg/bag,Composite woven bag(plastic bag inside)or PE bag, or 25kg/carton. (plastic bag inside).carton size:D36mm,H57mm ??Storage&Transportation??Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Avoid to contact water or moisture during Storing&Transporting. ??Usage??Used in make Adamantane Derivatives, apply to electronic industry. |
| Contact |
Mr.Yu / Mr.Mu |
| Telephone |
+86-830-2585019 |
| Email |
sales2@zhongbangst.com |
| Address |
Taifu Lingang Industrial Zone, Luxian County, Luzhou City, Sichuan,China |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Yongming Ren |
| Telephone |
+86-510-88302099 |
| Email |
renym@angchenchem.com |
| Address |
Rm B-1803,818 North Xingyuan Road,WuXi,China |
| Specifications |
98.5%min |
| Packing |
25 kg/drum |
| Telephone |
86-571-89939478 89939480 89939481 |
| Email |
ich@ichemie.com |
| Address |
Room 1224,Eastcom Mansion,398 Wensan Road,Hangzhou,310013 China |
| Contact |
liu |
| Telephone |
+86-22-59596766 |
| Email |
jinpeng@mxpharm.com |
| Address |
No.17,Taian Road,Jinghai Economic Development Area,Tjianjin City,P.R.China |