699-08-1 4-Iodophenetole
| product Name |
4-Iodophenetole |
| CAS No |
699-08-1 |
| Synonyms |
4-Ethoxy-4-iodobenzene; Ethyl 4-iodophenyl ether; 1-ethoxy-4-iodobenzene; 4-Ethoxyiodobenzene, 4-Iodophenyl ethyl ether; 1-Iodo-4-Ethyloxybenzene; p-Iodophenetole |
| Molecular Formula |
C8H9IO |
| Molecular Weight |
248.0609 |
| InChI |
InChI=1/C8H9IO/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.631g/cm3 |
| Melting point |
27-29℃ |
| Boiling point |
251°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
105.6°C |
| Vapour Pressur |
0.0333mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Telephone |
86-571-81956191 81956192 |
| Email |
Info@sinocochem.com |
| Address |
425 Ruiqi Mansion Moganshan Road , Hangzhou 310011 China. |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Specifications |
GC??99.5% |
| Packing |
20kg/drum or on request |
| Description |
Chemical Name: 4-Iodophenetole CAS No. 699-08-1 Content: GC??99.5% Appearance: pale yellow solid; Packing: 20kg/drum or on request; Productivity: 10 Tons/M |
| Contact |
Mr.Meng |
| Telephone |
+86-311-83833777 85381176 85381186 |
| Email |
sales@maisonchem.com.cn |
| Address |
Yingbin North Road,Xinji City,Hebei Province,China |