ChemNet > CAS > 69-96-5 DL-threo-3-Phenylserine hydrate
69-96-5 DL-threo-3-Phenylserine hydrate
| product Name |
DL-threo-3-Phenylserine hydrate |
| CAS No |
69-96-5 |
| Synonyms |
3-Phenylserine monohydrate; DL-?-Phenylserine threoform DL-Threo-?-phenylserine; β-hydroxyphenylalanine hydrate (1:1); Dl-Beta-Phenylserine Threo Form |
| Molecular Formula |
C9H13NO4 |
| Molecular Weight |
199.2038 |
| InChI |
InChI=1/C9H11NO3.H2O/c10-7(9(12)13)8(11)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H2 |
| EINECS |
200-721-2 |
| Molecular Structure |
|
| Melting point |
186℃ |
| Boiling point |
483.1°C at 760 mmHg |
| Flash point |
246°C |
| Vapour Pressur |
3.8E-10mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|