688-74-4 Tributyl borate
| product Name |
Tributyl borate |
| CAS No |
688-74-4 |
| Synonyms |
Tributoxyborane; Tri-n-butyl borate; Trinbutylboratecolorlessliq; Boric acid tri-n-butyl ester; n-Butyl borate; Boron n-butoxide; Tributyl borate; Borane, tributoxy-; Tributoxyborane-11B; Tri-N-Butoxyborane |
| Molecular Formula |
C12H27BO3 |
| Molecular Weight |
230.152 |
| InChI |
InChI=1/C12H27BO3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h4-12H2,1-3H3 |
| EINECS |
211-706-5 |
| Molecular Structure |
|
| Density |
0.859g/cm3 |
| Melting point |
-70℃ |
| Boiling point |
230.6°C at 760 mmHg |
| Refractive index |
1.409 |
| Flash point |
93.3°C |
| Water solubility |
decomposes |
| Vapour Pressur |
0.0987mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Chen Pin'gang |
| Telephone |
+86-21-51068321 51068322 |
| Email |
my@mychems.com |
| Address |
18A,East China building,Chang An road 1,138,Shanghai |
| Contact |
Mr Yu |
| Telephone |
021-51303635 |
| Email |
sale@daishangchem.com |
| Address |
Rm.1805-1813,Silver Bridge Tower,No.58,Jinxin Road,Pudong District, Shanghai 201206,China. |
| Contact |
peter |
| Telephone |
+86-21-38681880 |
| Email |
peter.xu@synmedia-chem.com |
| Address |
2/F, Block 3, East Area of Zhangjiang High Science and |