643-12-9 D-chiro-Inositol
| product Name |
D-chiro-Inositol |
| CAS No |
643-12-9 |
| Synonyms |
1D-chiro-inositol; (1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol |
| Molecular Formula |
C6H12O6 |
| Molecular Weight |
180.1559 |
| InChI |
InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m0/s1 |
| EINECS |
211-394-0 |
| Molecular Structure |
|
| Density |
2.039g/cm3 |
| Melting point |
230℃ |
| Boiling point |
291.326°C at 760 mmHg |
| Refractive index |
1.784 |
| Flash point |
143.387°C |
| Vapour Pressur |
0mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-68769091 |
| Email |
info@tritonchemtech.com |
| Address |
Room 717, 7/F, Information Tower, 1403 Minsheng Road, Shanghai, 200135, China |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Telephone |
+86-18192489506 |
| Email |
neil.chai@wlpingredient.com |
| Contact |
Mr. Li |
| Telephone |
+86-21-37100650;37100630 |
| Email |
Jacklee@xutaibio.com |
| Address |
Building 7, Lane 733, Yuandong Road, Fengxian District, Shanghai, China |