627-59-8 5-Methyl-2-hexanol
| product Name |
5-Methyl-2-hexanol |
| CAS No |
627-59-8 |
| Synonyms |
Isopentyl methyl carbinol~Methyl isoamyl carbinol; 5-methylhexan-2-ol; (2R)-5-methylhexan-2-ol; (2S)-5-methylhexan-2-ol |
| Molecular Formula |
C7H16O |
| Molecular Weight |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-6(2)4-5-7(3)8/h6-8H,4-5H2,1-3H3/t7-/m0/s1 |
| EINECS |
211-004-9 |
| Molecular Structure |
|
| Density |
0.816g/cm3 |
| Boiling point |
152.7°C at 760 mmHg |
| Refractive index |
1.418 |
| Flash point |
46.1°C |
| Vapour Pressur |
1.28mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
|
|
Featured China Suppliers
| Contact |
Mr. Wu |
| Telephone |
+86-13862111431 |
| Email |
sales2@senfeida.com |
| Address |
Hu Shu Guan Economic and Technological Development Zones, high-tech zone, Suzhou, China |