624-48-6 Dimethyl Maleate
| product Name |
Dimethyl Maleate |
| CAS No |
624-48-6 |
| Synonyms |
2-Butenedioic acid,dimethyl ester; Dimethylester kyseliny maleinove; Dimethyl cis-butenedioate:2-Butenedioic acid (Z)-, dimethyl ester; maleic acid dimethyl ester; dimethyl but-2-enedioate; dimethyl (2Z)-but-2-enedioate; DMM |
| Molecular Formula |
C6H8O4 |
| Molecular Weight |
144.1253 |
| InChI |
InChI=1/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3- |
| EINECS |
210-848-5 |
| Molecular Structure |
|
| Density |
1.124g/cm3 |
| Boiling point |
193°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
91.1°C |
| Vapour Pressur |
0.475mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R21/22:;
|
| Safety Description |
S23:;
S36/37:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mrs Zhuge |
| Telephone |
+86-571-88092925 88093529 |
| Email |
sunyb2007@hotmail.com |
| Address |
368 Dengyun Road, Hangzhou, Zhejiang, China |
| Telephone |
+86-917-3681489,3681104 |
| Email |
baoyu1098@163.com |
| Address |
Baoping Road, Baoji City of Shaanxi Province,PRC |
| Contact |
Liu Fucheng |
| Telephone |
+86-728-4719318 13807222398 |
| Email |
xcyy@chengyupharm.com |
| Address |
No.1 Yuefei Av., Yuekou town, Tianmen city, Hubei province, China |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Specifications |
99% |
| Packing |
200Kg/drum |
| Description |
Product name: Dimethyl Maleate Cas No. : 624-48-6 Appearance: Colorless liquid Purity: 99%min Packing: 200Kg/drum Use: As preservatives and organic synthetic intermediates for resin polymeric monomers, plasticizers, fatty oils |
| Contact |
Susan Xu |
| Telephone |
+86-531-82312885 15990993651 |
| Email |
yudong@yudong.com.cn |
| Address |
32 North Shanda Road,Jinan,Shandong,China |