622-51-5 p-Tolylurea
| product Name |
p-Tolylurea |
| CAS No |
622-51-5 |
| Synonyms |
4-Methylphenylurea; 1-(4-methylphenyl)urea |
| Molecular Formula |
C8H10N2O |
| Molecular Weight |
150.1778 |
| InChI |
InChI=1/C8H10N2O/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| EINECS |
210-739-2 |
| Molecular Structure |
|
| Density |
1.192g/cm3 |
| Melting point |
180-182℃ |
| Boiling point |
255.1°C at 760 mmHg |
| Refractive index |
1.62 |
| Flash point |
108.1°C |
| Vapour Pressur |
0.0166mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |