621-42-1 3-Acetamidophenol
| product Name |
3-Acetamidophenol |
| CAS No |
621-42-1 |
| Synonyms |
3-Hydroxyacetanilide; metacetamol; N-(3-hydroxyphenyl)acetamide |
| Molecular Formula |
C8H9NO2 |
| Molecular Weight |
151.1626 |
| InChI |
InChI=1/C8H9NO2/c1-6(10)9-7-3-2-4-8(11)5-7/h2-5,11H,1H3,(H,9,10) |
| EINECS |
210-687-0 |
| Molecular Structure |
|
| Density |
1.249g/cm3 |
| Melting point |
146-149℃ |
| Boiling point |
382.6°C at 760 mmHg |
| Refractive index |
1.618 |
| Flash point |
185.2°C |
| Vapour Pressur |
2.12E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-571-86691570 86691579 |
| Email |
sales@lzchemical.com |
| Telephone |
79265780336 |
| Email |
rakishev@aronis.ru |
| Address |
19-4-411 Novoyasenevsky prospekt 117593 Moscow RUSSIAN FEDERATION |