ChemNet > CAS > 603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%)
603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%)
| product Name |
2,3,6-trinitrophenol moistened with water (H2O ~40%) |
| CAS No |
603-10-1 |
| Molecular Formula |
C6H3N3O7 |
| Molecular Weight |
229.1039 |
| InChI |
InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H |
| Molecular Structure |
|
| Density |
1.856g/cm3 |
| Melting point |
119-120℃ |
| Boiling point |
337.9°C at 760 mmHg |
| Refractive index |
1.701 |
| Flash point |
151.1°C |
| Vapour Pressur |
5.2E-05mmHg at 25°C |
|