583-59-5 2-Methylcyclohexanol
| product Name |
2-Methylcyclohexanol |
| CAS No |
583-59-5 |
| Synonyms |
2-Methylcyclohexanol, mixture of cis and trans; 2-Methylcyclohexyl alcohol; (1R,2R)-2-methylcyclohexanol; (1R,2S)-2-methylcyclohexanol; (1S,2S)-2-methylcyclohexanol; (1S,2R)-2-methylcyclohexanol; O-methylcyclohexl alcohol; 2-metilcicloesanone |
| Molecular Formula |
C7H14O |
| Molecular Weight |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3/t6-,7+/m1/s1 |
| EINECS |
209-512-0 |
| Molecular Structure |
|
| Density |
0.925g/cm3 |
| Melting point |
-38℃ |
| Boiling point |
170.3°C at 760 mmHg |
| Refractive index |
1.462 |
| Flash point |
58.9°C |
| Water solubility |
slightly soluble |
| Vapour Pressur |
0.475mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20:;
|
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Miss ying |
| Telephone |
+86-571-86589381;86589382;86589383 |
| Email |
sales@qqpharm.com |
| Address |
No.3 Chuancheng South road,Xianju,Zhejiang,China |
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
sophia chu |
| Telephone |
+86-21-38860033,58482794 |
| Email |
sales@lanqichem.com |
| Address |
XinJiShan Industrial Area, Zhangshu City, JiangXi Province, China |