554-84-7 3-Nitrophenol
| product Name |
3-Nitrophenol |
| CAS No |
554-84-7 |
| Synonyms |
3-Hydroxy-1-nitrobenzene; m-Nitrophenol |
| Molecular Formula |
C6H5NO3 |
| Molecular Weight |
139.1088 |
| InChI |
InChI=1/C6H5NO3/c8-6-3-1-2-5(4-6)7(9)10/h1-4,8H |
| EINECS |
209-073-5 |
| Molecular Structure |
|
| Density |
1.395g/cm3 |
| Melting point |
96-98℃ |
| Boiling point |
277.6°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
126.9°C |
| Water solubility |
13.5 g/L (25℃) |
| Vapour Pressur |
0.00266mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:;
R33:;
R36/37/38:;
|
| Safety Description |
S22:;
S26:;
S36/37/39:;
S45:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Amanda Zhang |
| Telephone |
+86-519-85193679 |
| Email |
zhangyue@cuchem.com |
| Address |
5/F B Flat, XingBei Building NO. 391 Tongjiang road Changzhou Jiangsu China |
| Telephone |
0086-21-54277770 |
| Email |
contact@world-prospect.com |
| Address |
8F, Building 88, No.1199, Qinzhou North Road, Shanghai, China |
| Contact |
Mr. Ice Leng |
| Telephone |
+86-791-86629460 |
| Email |
iceleng@biochemjx.com |
| Address |
1-6F, 118 Xinzhou road, Nanchang, Jiangxi, China |
| Specifications |
99% min |
| Packing |
25kg 50kg drum or bag |
| Description |
What is the chemical of m-Nitrophenol ? Appearance: yellow to brown powder ; Assay: 99% min by HPLC ; IR Identity: conform to standard ; HNMR?? conform to standard ; carbon spectrum: conform to standard ; Water by K. F.:0.5% max or as per the customer??s request ; Loss on drying:0.5% max. or as per the customer??s request ; Melting point: 96-98??; |
| Contact |
Mr. Alexander Wang |
| Telephone |
+86-22-83739603 |
| Email |
sales@yuansu-reagent.com |
| Address |
No. 268, Yuliang Street, Dagang Street, Binhai New Area, Tianjin, China |