538-58-9 Dibenzylideneacetone
| product Name |
Dibenzylideneacetone |
| CAS No |
538-58-9;35225-79-7 |
| Synonyms |
1,5-Diphenyl-1,4-pentadien-3-one; distyryl ketone; trans,trans-Dibenzylideneacetone; Dibenzylidene acetone; 1,5-diphenylpenta-1,4-dien-3-one; (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one; (1Z,4Z)-1,5-diphenylpenta-1,4-dien-3-one; (1E)-1,5-diphenylpenta-1,4-dien-3-one; 1,5-Diphenyl-3-pentadienone |
| Molecular Formula |
C17H14O |
| Molecular Weight |
234.2925 |
| InChI |
InChI=1/C17H14O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14H/b13-11+,14-12u |
| EINECS |
208-697-5 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Melting point |
112-114℃ |
| Boiling point |
400.7°C at 760 mmHg |
| Refractive index |
1.649 |
| Flash point |
176.2°C |
| Vapour Pressur |
1.25E-06mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |