5334-30-5 PP3
| product Name |
PP3 |
| CAS No |
5334-30-5 |
| Synonyms |
4-Amino-1-phenylpyrazolo[3,4-d]pyrimidine; 1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Molecular Formula |
C11H9N5 |
| Molecular Weight |
211.2227 |
| InChI |
InChI=1/C11H9N5/c12-10-9-6-15-16(11(9)14-7-13-10)8-4-2-1-3-5-8/h1-7H,(H2,12,13,14) |
| Molecular Structure |
|
| Density |
1.44g/cm3 |
| Boiling point |
364°C at 760 mmHg |
| Refractive index |
1.77 |
| Flash point |
173.9°C |
| Vapour Pressur |
1.74E-05mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|