ChemNet > CAS > 5228-48-8 2-Methyl-5-nitro-2H-indazole
5228-48-8 2-Methyl-5-nitro-2H-indazole
| product Name |
2-Methyl-5-nitro-2H-indazole |
| CAS No |
5228-48-8 |
| Synonyms |
Methylnitroindazole; 2-Methyl-5-nitro-1H-indazole |
| Molecular Formula |
C8H7N3O2 |
| Molecular Weight |
177.1601 |
| InChI |
InChI=1/C8H7N3O2/c1-10-5-6-4-7(11(12)13)2-3-8(6)9-10/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.425g/cm3 |
| Melting point |
161-163℃ |
| Boiling point |
364.502°C at 760 mmHg |
| Refractive index |
1.677 |
| Flash point |
174.245°C |
| Vapour Pressur |
0mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|