ChemNet > CAS > 502-85-2 4-Hydroxybutyric acid, sodium salt
502-85-2 4-Hydroxybutyric acid, sodium salt
| product Name |
4-Hydroxybutyric acid, sodium salt |
| CAS No |
502-85-2 |
| Synonyms |
Sodium Oxybate; 4-Hydroxybutyric acid sodium salt; Sodium 4-hydroxybutyrate; Gamma-Hydroxybutyrate Sodium Salt; sodium 4-hydroxybutanoate |
| Molecular Formula |
C4H7NaO3 |
| Molecular Weight |
126.0863 |
| InChI |
InChI=1/C4H8O3.Na/c5-3-1-2-4(6)7;/h5H,1-3H2,(H,6,7);/q;+1/p-1 |
| EINECS |
207-953-3 |
| Molecular Structure |
|
| Melting point |
143-147℃ |
| Boiling point |
295.6°C at 760 mmHg |
| Flash point |
146.8°C |
| Vapour Pressur |
0.000156mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
79265780336 |
| Email |
rakishev@aronis.ru |
| Address |
19-4-411 Novoyasenevsky prospekt 117593 Moscow RUSSIAN FEDERATION |