50-84-0 2,4-Dichlorobenzoic acid
| product Name |
2,4-Dichlorobenzoic acid |
| CAS No |
50-84-0 |
| Synonyms |
2,4-DCBA; 2,4-Dichlolrobenzoic Acid; 2,4-dichlorobenzoate |
| Molecular Formula |
C7H3Cl2O2 |
| Molecular Weight |
190.0041 |
| InChI |
InChI=1/C7H4Cl2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11)/p-1 |
| EINECS |
200-067-8 |
| Molecular Structure |
|
| Melting point |
160-164℃ |
| Boiling point |
309.5°C at 760 mmHg |
| Flash point |
141°C |
| Water solubility |
0.36 g/L (15℃) |
| Vapour Pressur |
0.000275mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S22:;
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-571-88383188;86970388;+49-211-550203-21 |
| Email |
sales@dragon-chem.com |
| Address |
16/Fl., Tower B, Qingchun Development Building, 66 East Qingchun Rd., Hangzhou, China |
| Telephone |
+86-571-86919872 |
| Email |
gm@ryxchina.com |
| Address |
Room 911,Unit B3,Xihu International Science and Technology Building,No.391,Wener road,Xihu District,Hangzhou city,Zhejiang province,China. |
| Contact |
Mr.Chen |
| Telephone |
+86-571-87040515 |
| Email |
chenhk@hzph.com |
| Address |
QinglianBldg.No,139QingchunRd,HangzhouCity,Zhejiang,China |
| Description |
Chemical name: 2,4-Dichlorobenzoic acid CAS: 50-84-0 Molecular formula: C7H4Cl2O2 Molecular weight: 191.01 Appearance: White to pale yellow needle crystal or powder Content:99% |
| Contact |
Sunny liu |
| Telephone |
021-68758016 |
| Email |
chemvia@chemvia.com |
| Address |
22F, Huadu Mansion, No. 838, Zhangyang Rd, Pudong,Shanghai, China |
| Contact |
mr liu |
| Telephone |
+86 10-6444 6226, 6445 5497, 5361 0655 |
| Email |
info@bj-newcenturychem.com |
| Address |
Rm.1903, Hengrun International Mansion, No.32,North Third Ring West Rd.,Haidian Dist.,Beijing,100086, China |