ChemNet > CAS > 4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
4966-90-9 4-Hydroxy-6-methyl-3-nitro-2-pyridone
| product Name |
4-Hydroxy-6-methyl-3-nitro-2-pyridone |
| CAS No |
4966-90-9 |
| Synonyms |
2-hydroxy-6-methyl-3-nitropyridin-4(1H)-one |
| Molecular Formula |
C6H6N2O4 |
| Molecular Weight |
170.1228 |
| InChI |
InChI=1/C6H6N2O4/c1-3-2-4(9)5(8(11)12)6(10)7-3/h2H,1H3,(H2,7,9,10) |
| Molecular Structure |
|
| Density |
1.53g/cm3 |
| Melting point |
293-296℃ |
| Boiling point |
265.6°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
114.4°C |
| Vapour Pressur |
0.00125mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|