495-69-2 Hippuric acid
| product Name |
Hippuric acid |
| CAS No |
495-69-2;21251-67-2;66407-11-2;140480-84-8;892119-18-5;892119-19-6 |
| Synonyms |
N-Benzoylglycine; [(phenylcarbonyl)amino]acetate; 2-benzamidoacetic acid; Bz-Gly-OH |
| Molecular Formula |
C9H8NO3 |
| Molecular Weight |
178.1653 |
| InChI |
InChI=1/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)/p-1 |
| EINECS |
207-806-3 |
| Molecular Structure |
|
| Melting point |
188-191℃ |
| Boiling point |
464.1°C at 760 mmHg |
| Flash point |
234.5°C |
| Vapour Pressur |
2.06E-09mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Telephone |
+86-512-67773280;67771201 |
| Email |
sales@amberchem.cn |
| Address |
Room 407, Xinguo Business Building, No.1088 Youxin Road, Suzhou City, Jiangsu, P.R. China |
| Contact |
Mr Zhang |
| Telephone |
+86-577-88799961 88795800 88799963 88799960 88799962 |
| Email |
sales@cnjxchem.com |
| Address |
Yanjiang Industry Zone ,Wenzhou,China |
| Telephone |
+86-571-86059031 |
| Email |
sales@kenduochem.com |
| Address |
Weiken road 418 ,Xiasha Economic and technological development zone , Hangzhou,Zhejiang China. |