487-26-3 Flavanone
| product Name |
Flavanone |
| CAS No |
487-26-3 |
| Synonyms |
2,3-Dihydroflavone~2-Phenylchromanone; 2,3-dihydro-2-phenylchroman-4-one; 2,3-Dihydroflavone; 2-phenyl-2,3-dihydro-4H-chromen-4-one; (2S)-2-phenyl-2,3-dihydro-4H-chromen-4-one; (2R)-2-phenyl-2,3-dihydro-4H-chromen-4-one; DL-Flavanone |
| Molecular Formula |
C15H12O2 |
| Molecular Weight |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2/t15-/m1/s1 |
| EINECS |
207-654-8 |
| Molecular Structure |
|
| Density |
1.192g/cm3 |
| Melting point |
75-78℃ |
| Boiling point |
386.2°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
181.9°C |
| Vapour Pressur |
3.6E-06mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|