480-65-9 Isodehydroacetic acid
| product Name |
Isodehydroacetic acid |
| CAS No |
480-65-9 |
| Synonyms |
4,6-dimethyl-5-formylpyran-2-one; isohydracetic acid; 5-Carboxy-4,6-dimethyl-2-pyrone; 4,6-Dimethyl-2-oxo-2H-pyran-5-carboxylic Acid; 4,6-Dimethylcoumalic acid; 4,6-dimethyl-2-oxo-2H-pyran-5-carboxylate |
| Molecular Formula |
C8H7O4 |
| Molecular Weight |
167.1393 |
| InChI |
InChI=1/C8H8O4/c1-4-3-6(9)12-5(2)7(4)8(10)11/h3H,1-2H3,(H,10,11)/p-1 |
| EINECS |
207-554-4 |
| Molecular Structure |
|
| Melting point |
154℃ |
| Boiling point |
303.4°C at 760 mmHg |
| Flash point |
125.7°C |
| Vapour Pressur |
0.000215mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
41764749051 |
| Email |
sales@edasascientific.com |
| Address |
Leninskie Gory 1/3, Chemistry Department of Moscow State University 119192 Moscow RUSSIAN FEDERATION |