453-13-4 1,3-difluoro-2-propanol
| product Name |
1,3-difluoro-2-propanol |
| CAS No |
453-13-4 |
| Synonyms |
Geiftor; 1,3-difluoropropan-2-one |
| Molecular Formula |
C3H4F2O |
| Molecular Weight |
94.0601 |
| InChI |
InChI=1/C3H4F2O/c4-1-3(6)2-5/h1-2H2 |
| EINECS |
207-216-6 |
| Molecular Structure |
|
| Density |
1.092g/cm3 |
| Boiling point |
85.7°C at 760 mmHg |
| Refractive index |
1.304 |
| Flash point |
22°C |
| Vapour Pressur |
68.5mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|