4441-63-8 Cyclohexanebutyric acid
| product Name |
Cyclohexanebutyric acid |
| CAS No |
4441-63-8 |
| Synonyms |
4-Cyclohexylbutyric acid; cadmium bis(4-cyclohexylbutanoate); sodium 4-cyclohexylbutanoate; lead(2+) bis(4-cyclohexylbutanoate); lithium 4-cyclohexylbutanoate; mercury bis(4-cyclohexylbutanoate); potassium 4-cyclohexylbutanoate; silver(1+) 4-cyclohexylbutanoate; strontium bis(4-cyclohexylbutanoate); magnesium bis(4-cyclohexylbutanoate); 4-cyclohexylbutanoate |
| Molecular Formula |
C10H17O2 |
| Molecular Weight |
169.2413 |
| InChI |
InChI=1/C10H18O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h9H,1-8H2,(H,11,12)/p-1 |
| EINECS |
224-665-3 |
| Molecular Structure |
|
| Melting point |
27-31℃ |
| Boiling point |
283.3°C at 760 mmHg |
| Flash point |
138.9°C |
| Vapour Pressur |
0.000831mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|