4358-86-5 DL-Mandelamide
| product Name |
DL-Mandelamide |
| CAS No |
4358-86-5;4410-31-5 |
| Synonyms |
Mandelamide; NSC 16603; Benzeneacetamide, alpha-hydroxy-; 2-hydroxy-2-phenylacetamide |
| Molecular Formula |
C8H9NO2 |
| Molecular Weight |
151.1626 |
| InChI |
InChI=1/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11) |
| Molecular Structure |
|
| Density |
1.246g/cm3 |
| Boiling point |
345.5°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
162.7°C |
| Vapour Pressur |
2.33E-05mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|