4253-91-2 n-Propyl sulfoxide
| product Name |
n-Propyl sulfoxide |
| CAS No |
4253-91-2 |
| Synonyms |
Dipropyl sulfoxide; Di-n-Propylsulfoxide; Di-n-propyl sulfoxid; Di-n-propyl sulfoxid [German]; Di-n-propyl sulfoxide; Di-n-propyl sulphoxide; NSC 75838; Sulfoxide, dipropyl; 1,1'-Sulphinylbispropane; Propane, 1,1'-sulfinylbis-; Propyl sulfoxide (8CI); 1-(propylsulfinyl)propane |
| Molecular Formula |
C6H14OS |
| Molecular Weight |
134.2398 |
| InChI |
InChI=1/C6H14OS/c1-3-5-8(7)6-4-2/h3-6H2,1-2H3 |
| EINECS |
224-227-1 |
| Molecular Structure |
|
| Density |
0.979g/cm3 |
| Boiling point |
243.9°C at 760 mmHg |
| Refractive index |
1.476 |
| Flash point |
101.3°C |
| Vapour Pressur |
0.0488mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|