ChemNet > CAS > 4251-21-2 p-Phenylenedipropionic acid
4251-21-2 p-Phenylenedipropionic acid
| product Name |
p-Phenylenedipropionic acid |
| CAS No |
4251-21-2 |
| Molecular Formula |
C12H12O4 |
| Molecular Weight |
220.2224 |
| InChI |
InChI=1/C12H14O4/c13-11(14)7-5-9-1-2-10(4-3-9)6-8-12(15)16/h1-4H,5-8H2,(H,13,14)(H,15,16)/p-2 |
| EINECS |
224-215-6 |
| Molecular Structure |
|
| Melting point |
229-233℃ |
| Boiling point |
423.8°C at 760 mmHg |
| Flash point |
224.3°C |
| Vapour Pressur |
6.13E-08mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|