4214-79-3 5-Chloro-2-pyridinol
| product Name |
5-Chloro-2-pyridinol |
| CAS No |
4214-79-3 |
| Synonyms |
5-Chloro-2-hydroxypyridine; 5-Chloro-2-hydrxypyridine; 2-Hydroxy-5-chloropyridine; 2-hydroxy-5-chloro pyridine; 5-chloropyridin-2(1H)-one; 5-Chloropyridin-2-ol; 5-Chloropyridin-2-ol |
| Molecular Formula |
C5H4ClNO |
| Molecular Weight |
129.5444 |
| InChI |
InChI=1/C5H4ClNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8) |
| EINECS |
224-146-1 |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
162-165℃ |
| Boiling point |
290.7°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
129.6°C |
| Vapour Pressur |
0.00204mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Contact |
marketing manager |
| Telephone |
+86-21-32091125 |
| Email |
info@vikichemicals.com |
| Address |
Unit A, 18/F Yonghua Mansion, 138 Pudong Avenue, Shanghai 200120, China |
| Contact |
Wang Yang |
| Telephone |
+86-15641826633 |
| Email |
sales@fengchengchem.com |
| Address |
Fuxin Yi-Ma-Tu Fluorine Chemical Industrial Zone, Liaoning, China |
| Contact |
mr cheng |
| Telephone |
+86-775-3628111 |
| Email |
jyjj20050401@126.com |
| Address |
Guiping City, Guangxi Changan industrial concentration area |