40353-34-2 7-Nitro-1-tetralone
| product Name |
7-Nitro-1-tetralone |
| CAS No |
40353-34-2 |
| Synonyms |
7-Nitrotetralone; 7-Nitro-3,4-dihydronaphthalen-1(2H)-one |
| Molecular Formula |
C10H9NO3 |
| Molecular Weight |
191.18 |
| InChI |
InChI=1/C10H9NO3/c12-10-3-1-2-7-4-5-8(11(13)14)6-9(7)10/h4-6H,1-3H2 |
| EINECS |
254-887-6 |
| Molecular Structure |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |