ChemNet > CAS > 40263-57-8 2-Iodo-3-hydroxypyridine
40263-57-8 2-Iodo-3-hydroxypyridine
| product Name |
2-Iodo-3-hydroxypyridine |
| CAS No |
40263-57-8 |
| Synonyms |
2-Iodo-3-pyridinol; 3-Hydroxy-2-iodopyridine; 2-IODOPYRIDIN-3-OL; 3-Pyridinol, 2-iodo-; Pyridine, 2-iodo-3-hydroxy-; 2-HYDROXY-3-IODOPYRIDINE |
| Molecular Formula |
C5H4INO |
| Molecular Weight |
220.9958 |
| InChI |
InChI=1/C5H4INO/c6-5-4(8)2-1-3-7-5/h1-3,8H |
| EINECS |
254-864-0 |
| Molecular Structure |
|
| Density |
2.142g/cm3 |
| Boiling point |
296.603°C at 760 mmHg |
| Refractive index |
1.683 |
| Flash point |
133.181°C |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
Xn:;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|