39115-96-3 3-Bromobenzhydrazide
| product Name |
3-Bromobenzhydrazide |
| CAS No |
39115-96-3 |
| Synonyms |
3-Bromobenzoic hydrazide; (3-Bromobenzoyl)hydrazine; (m-Bromobenzoyl)hydrazine; 3-Bromobenzohydrazide; Benzoic acid, 3-bromo-, hydrazide; Benzoic acid, m-bromo-, hydrazide; m-Bromobenzohydrazide; m-Bromobenzoic acid hydrazide; m-Bromobenzoic hydrazide |
| Molecular Formula |
C7H7BrN2O |
| Molecular Weight |
215.0473 |
| InChI |
InChI=1/C7H7BrN2O/c8-6-3-1-2-5(4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| EINECS |
254-298-4 |
| Molecular Structure |
|
| Density |
1.615g/cm3 |
| Melting point |
155-156℃ |
| Boiling point |
368.5°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
176.7°C |
| Vapour Pressur |
4.42E-06mmHg at 25°C |
| Hazard Symbols |
Xi:;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Miss. Sucy |
| Telephone |
+86 755 27800161 |
| Email |
sales@todabio.com |
| Address |
5th Floor, Building 8, Changyuan New Material Port, No. 2, Gaoxin Zhongyi, Science and Technology Park, Nanshan District, Shenzhen |