367-51-1 Sodium thioglycolate
| product Name |
Sodium thioglycolate |
| CAS No |
367-51-1 |
| Synonyms |
Thioglycolic acid, sodium salt; Mercaptoacetic acid sodium salt; Sodium mercaptoacetate; Thioglycolic acid sodium salt; sodium sulfanylacetate |
| Molecular Formula |
C2H3NaO2S |
| Molecular Weight |
114.0988 |
| InChI |
InChI=1/C2H4O2S.Na/c3-2(4)1-5;/h5H,1H2,(H,3,4);/q;+1/p-1 |
| EINECS |
206-696-4 |
| Molecular Structure |
|
| Melting point |
>300℃ |
| Boiling point |
225.5°C at 760 mmHg |
| Flash point |
99.8°C |
| Water solubility |
soluble |
| Vapour Pressur |
0.0314mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R38:;
|
| Safety Description |
S36:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Description |

|
| Contact |
qianjin yi |
| Telephone |
+86-535-5203189 5203569 |
| Email |
aotongchem@188.com |
| Address |
xishou minsheng road,qixia ShanDong P.R.CHINA |
| Contact |
Mr. He |
| Telephone |
+86-24-74570274;+86-24-74127073;+86-24-74127072;Export sales office??+86-24-74570273;084-24-74127079;+86-24-74127078;Supply:+86-24-74570267;+86-24-74127070;+86-24-74127071;The director of the office??+86-24-74562421;+86-24-74127078 |
| Email |
tlfrf@mail.tlptt.ln.cn;hsiaobo@minefriend.com |
| Address |
No.18 Beisan Road, Tiexi Street,Yinzhou Dist., Tieling City 112002,Liaoning, China |
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |